4-Amino-1-Boc-piperidine
- Product Name4-Amino-1-Boc-piperidine
- CAS87120-72-7
- MFC10H20N2O2
- MW200.28
- EINECS1312995-182-4
- MOL File87120-72-7.mol
Chemical Properties
| Melting point | 50°C |
| Boiling point | 80/0.037mm |
| Density | 1.041±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.10±0.20(Predicted) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to pale yellow to beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h8H,4-7,11H2,1-3H3 |
| InChIKey | LZRDHSFPLUWYAX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(N)CC1 |
| CAS DataBase Reference | 87120-72-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22-20/21/2236/37/38 |
| Safety Statements | 26-36/37/39-22-222636/37/39 |
| RIDADR | 3259 |
| WGK Germany | 2 |
| F | 10-34 |
| Hazard Note | Irritant |
| TSCA | N |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |