2-Ethylnitrobenzene
- Product Name2-Ethylnitrobenzene
- CAS612-22-6
- MFC8H9NO2
- MW151.16
- EINECS210-299-1
- MOL File612-22-6.mol
Chemical Properties
| Melting point | -13--10 °C(lit.) |
| Boiling point | 172-174 °C18 mm Hg(lit.) |
| Density | 1.127 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 228 °F |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 1865655 |
| InChI | InChI=1S/C8H9NO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1(CC)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 612-22-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-ethyl-2-nitro-(612-22-6) |
| EPA Substance Registry System | Benzene, 1-ethyl-2-nitro- (612-22-6) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HS Code | 2904200090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
