2,2'-Dihydroxybenzophenone
- Product Name2,2'-Dihydroxybenzophenone
- CAS835-11-0
- MFC13H10O3
- MW214.22
- EINECS212-639-4
- MOL File835-11-0.mol
Chemical Properties
| Melting point | 61-62.5 °C(lit.) |
| Boiling point | 333°C (estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | RT, stored under nitrogen |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 7.32±0.30(Predicted) |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C13H10O3/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8,14-15H |
| InChIKey | YIYBRXKMQFDHSM-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1O)(C1=CC=CC=C1O)=O |
| CAS DataBase Reference | 835-11-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
