Phentolamine mesilate
- Product NamePhentolamine mesilate
- CAS65-28-1
- MFC18H23N3O4S
- MW377.46
- EINECS200-604-6
- MOL File65-28-1.mol
Chemical Properties
| Melting point | 180-182 °C(lit.) |
| Density | 1.2256 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol: 26 mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | 50 mg/mL |
| Merck | 14,7264 |
| Stability | Aq. Solutions Cannot be Stored |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| SMILES | N(CC1=NCCN1)(C1C=CC(C)=CC=1)C1C=CC=C(O)C=1.S(=O)(=O)(O)C |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | SL5430000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LDLo scu-rat: 275 mg/kg NIIRDN 6,667,82 |
