Phentolamine mesilate
- Product NamePhentolamine mesilate
- CAS65-28-1
- CBNumberCB5708736
- MFC18H23N3O4S
- MW377.46
- EINECS200-604-6
- MDL NumberMFCD00134201
- MOL File65-28-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 180-182 °C(lit.) |
| Density | 1.2256 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol: 26 mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | 50 mg/mL |
| Merck | 14,7264 |
| Stability | Aq. Solutions Cannot be Stored |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| SMILES | N(CC1=NCCN1)(C1C=CC(C)=CC=1)C1C=CC=C(O)C=1.S(=O)(=O)(O)C |
| FDA UNII | Y7543E5K9T |
| NCI Drug Dictionary | phentolamine mesylate |
| UNSPSC Code | 41116107 |
| NACRES | NA.77 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 3249 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | SL5430000 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29332900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| Toxicity | LDLo scu-rat: 275 mg/kg NIIRDN 6,667,82 | |||||||||
| NFPA 704: |
|
