7-Ethyl-10-hydroxycamptothecin
- Product Name7-Ethyl-10-hydroxycamptothecin
- CAS86639-52-3
- MFC22H20N2O5
- MW392.4
- EINECS643-093-9
- MOL File86639-52-3.mol
Chemical Properties
| Melting point | 217 °C |
| Boiling point | 810.3±65.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| refractive index | 21.5 ° (C=0.2, THF) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble1mg/mL |
| form | powder |
| pka | 9.13±0.40(Predicted) |
| color | Off-white |
| optical activity | Consistent with structure |
| Stability | Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. |
| InChI | InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
| InChIKey | FJHBVJOVLFPMQE-QFIPXVFZSA-N |
| SMILES | N1C2C(=CC(O)=CC=2)C(CC)=C2CN3C(C=12)=CC1[C@](CC)(O)C(=O)OCC=1C3=O |
| CAS DataBase Reference | 86639-52-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UQ0491000 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 1B STOT RE 1 |

