Pigment Orange 5
- Product NamePigment Orange 5
- CAS3468-63-1
- MFC16H10N4O5
- MW338.27
- EINECS222-429-4
- MOL File3468-63-1.mol
Chemical Properties
| Melting point | 306°C(lit.) |
| Boiling point | 474.44°C (rough estimate) |
| Density | 1.3138 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | Chloroform (Very Slightly), Tetrahydrofuran (Slightly, Heated) |
| Colour Index | 12075 |
| form | Solid |
| pka | 13.45±0.50(Predicted) |
| color | Orange to Dark Red |
| BRN | 964718 |
| Henry's Law Constant | 1.1×109 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,21H/b18-17+ |
| InChIKey | HBHZKFOUIUMKHV-ISLYRVAYSA-N |
| SMILES | Oc1ccc2ccccc2c1\N=N\c3ccc(cc3[N+]([O-])=O)[N+]([O-])=O |
| LogP | 3.610 (est) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-68-40-36 |
| Safety Statements | 16-36/37-26 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| RTECS | QL3854000 |
| TSCA | TSCA listed |
| HS Code | 32041700 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Muta. 2 |
| Hazardous Substances Data | 3468-63-1(Hazardous Substances Data) |
