Pigment Red 179
- Product NamePigment Red 179
- CAS5521-31-3
- MFC26H14N2O4
- MW418.4
- EINECS226-866-1
- MOL File5521-31-3.mol
Chemical Properties
| Melting point | >400°C |
| Boiling point | 694.8±28.0 °C(Predicted) |
| Density | 1.594±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -2.29±0.20(Predicted) |
| form | powder |
| color | Orange to Brown to Dark purple |
| Water Solubility | 5.5μg/L at 23℃ |
| semiconductor properties | N-type (mobility=10-5cm2/V·s) |
| λmax | 550nm(H2SO4)(lit.) |
| InChI | InChI=1S/C26H14N2O4/c1-27-23(29)15-7-3-11-13-5-9-17-22-18(26(32)28(2)25(17)31)10-6-14(20(13)22)12-4-8-16(24(27)30)21(15)19(11)12/h3-10H,1-2H3 |
| InChIKey | PJQYNUFEEZFYIS-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C3C4C(C5=CC=C6C7=C5C(C=4C=C2)=CC=C7C(=O)N(C)C6=O)=CC=C3C(=O)N1C |
| LogP | -0.033 at 23℃ |
| EPA Substance Registry System | 2,9-Dimethylanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone (5521-31-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | CB1590000 |
| TSCA | TSCA listed |
| HS Code | 2925.19.4200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
