2,4-Dichloropyridine
- Product Name2,4-Dichloropyridine
- CAS26452-80-2
- MFC5H3Cl2N
- MW147.99
- EINECS247-717-7
- MOL File26452-80-2.mol
Chemical Properties
| Melting point | -1 °C |
| Boiling point | 189-190 °C (lit.) 76-78 °C/23 mmHg (lit.) |
| Density | 1.37 |
| refractive index | 1.55-1.554 |
| Flash point | 189-190°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform |
| form | Yellow to Pale Orange Liquid |
| pka | 0.12±0.10(Predicted) |
| color | Colorless to Red to Green |
| BRN | 108666 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 26452-80-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 25-38-41-43-36/37/38-20/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | NC3410400 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
