3,4-Difluorobenzyl alcohol
- Product Name3,4-Difluorobenzyl alcohol
- CAS85118-05-4
- MFC7H6F2O
- MW144.12
- EINECS285-657-3
- MOL File85118-05-4.mol
Chemical Properties
| Boiling point | 101.45°C (rough estimate) |
| Density | 1.262 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 208 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13+-.0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Red to Green |
| Specific Gravity | 1.262 |
| BRN | 9043426 |
| InChI | InChI=1S/C7H6F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4H2 |
| InChIKey | GNQLTCVBSGVGHC-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 85118-05-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenemethanol, 3,4-difluoro-(85118-05-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29062990 |
