| Boiling point |
101.45°C (rough estimate) |
| Density |
1.262 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.49(lit.) |
| Flash point |
208 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
13+-.0.10(Predicted) |
| form |
clear liquid |
| color |
Colorless to Red to Green |
| Specific Gravity |
1.262 |
| BRN |
9043426 |
| InChI |
InChI=1S/C7H6F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4H2 |
| InChIKey |
GNQLTCVBSGVGHC-UHFFFAOYSA-N |
| SMILES |
C1(CO)=CC=C(F)C(F)=C1 |
| CAS DataBase Reference |
85118-05-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzenemethanol, 3,4-difluoro-(85118-05-4) |
