| Melting point |
>300 C |
| bulk density |
160kg/m3 |
| storage temp. |
Store at +15°C to +25°C. |
| solubility |
820g/l |
| form |
Crystalline Powder |
| color |
Off-white to beige or light gray |
| PH |
5.7 (10g/l, H2O, 20℃) |
| Odor |
Characteristic odour |
| Water Solubility |
soluble |
| Stability |
Stable. Incompatible with strong oxidizing agents, strong acids. |
| InChI |
InChI=1S/C12H11NO3S.Na.H/c14-17(15,16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10;;/h1-9,13H,(H,14,15,16);; |
| InChIKey |
DGXTZMPQSMIFEC-UHFFFAOYSA-M |
| SMILES |
N(C1C=CC=CC=1)C1C=CC(S(O)(=O)=O)=CC=1.[NaH] |
| CAS DataBase Reference |
6152-67-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 4-(phenylamino)-, monosodium salt (6152-67-6) |
