3,4-Difluoroaniline
- Product Name3,4-Difluoroaniline
- CAS3863-11-4
- MFC6H5F2N
- MW129.11
- EINECS223-381-7
- MOL File3863-11-4.mol
Chemical Properties
| Melting point | 22°C |
| Boiling point | 77 °C/7 mmHg (lit.) |
| Density | 1.302 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to lump to clear liquid |
| pka | 3+-.0.10(Predicted) |
| color | White or Colorless to Yellow |
| Specific Gravity | 1.302 |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 971235 |
| InChI | InChI=1S/C6H5F2N/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| InChIKey | AXNUZKSSQHTNPZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 3863-11-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Difluoroaniline(3863-11-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN 2941 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CX9871900 |
| F | 8-10-23 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |