4-(Trifluoromethoxy)aniline
- Product Name4-(Trifluoromethoxy)aniline
- CAS461-82-5
- MFC7H6F3NO
- MW177.12
- EINECS207-317-5
- MOL File461-82-5.mol
Chemical Properties
| Boiling point | 73-75 °C10 mm Hg(lit.) |
| Density | 1.32 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 177 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 3.75±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.310 |
| BRN | 2090209 |
| Stability | Hygroscopic |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4H,11H2 |
| InChIKey | XUJFOSLZQITUOI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 461-82-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 24/25-33-38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 2941 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HazardClass | IRRITANT, TOXIC |
| PackingGroup | III |
| HS Code | 29222900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT RE 2 |