3,4-Difluoronitrobenzene
- Product Name3,4-Difluoronitrobenzene
- CAS369-34-6
- MFC6H3F2NO2
- MW159.09
- EINECS206-718-2
- MOL File369-34-6.mol
Chemical Properties
| Melting point | -12 °C |
| Boiling point | 78 °C/11.3 mmHg |
| Density | 1.45 |
| refractive index | 1.51 |
| Flash point | 80 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | clear liquid |
| color | Light yellow to Brown |
| Specific Gravity | 1.437 |
| Water Solubility | insoluble |
| BRN | 1944996 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3F2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| InChIKey | RUBQQRMAWLSCCJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)c(F)c1 |
| CAS DataBase Reference | 369-34-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Difluoronitrobenzene(369-34-6) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | CZ5710000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
