3,4,5-Trifluoronitrobenzene
- Product Name3,4,5-Trifluoronitrobenzene
- CAS66684-58-0
- MFC6H2F3NO2
- MW177.08
- EINECS266-447-0
- MOL File66684-58-0.mol
Chemical Properties
| Boiling point | 208.6±35.0 °C(Predicted) |
| Density | 1.517 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 167 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 2455018 |
| InChI | InChI=1S/C6H2F3NO2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H |
| InChIKey | PTTUMBGORBMNBN-UHFFFAOYSA-N |
| SMILES | C1(F)=CC([N+]([O-])=O)=CC(F)=C1F |
| CAS DataBase Reference | 66684-58-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
