1-Fluoro-3-nitrobenzene
- Product Name1-Fluoro-3-nitrobenzene
- CAS402-67-5
- MFC6H4FNO2
- MW141.1
- EINECS206-953-0
- MOL File402-67-5.mol
Chemical Properties
| Melting point | 1.7 °C (lit.) |
| Boiling point | 198 °C |
| Density | 1.33 |
| refractive index | 1.53 |
| RTECS | DA1385000 |
| Flash point | 87 °C |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Specific Gravity | 1.325 |
| Water Solubility | immiscible |
| BRN | 1862210 |
| InChI | InChI=1S/C6H4FNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H |
| InChIKey | WMASLRCNNKMRFP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 402-67-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-fluoro-3-nitro-(402-67-5) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 23/24/25-33-20/21/22 |
| Safety Statements | 36/37-45-36 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral STOT RE 2 |
