3-(4-Methylpiperazin-1-yl)aniline
- Product Name3-(4-Methylpiperazin-1-yl)aniline
- CAS148546-99-0
- MFC11H17N3
- MW191.27
- EINECS
- MOL File148546-99-0.mol
Chemical Properties
| Melting point | 98-99 |
| Boiling point | 353.1±37.0 °C(Predicted) |
| Density | 1.092±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.88±0.42(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C11H17N3/c1-13-5-7-14(8-6-13)11-4-2-3-10(12)9-11/h2-4,9H,5-8,12H2,1H3 |
| InChIKey | RJGHJWKQCJAJEP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(N2CCN(C)CC2)=C1 |
| CAS DataBase Reference | 148546-99-0 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | 2923 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |