2-Fluoro-4-nitrophenol
- Product Name2-Fluoro-4-nitrophenol
- CAS403-19-0
- MFC6H4FNO3
- MW157.1
- EINECS
- MOL File403-19-0.mol
Chemical Properties
| Melting point | 120-122 °C (lit.) |
| Boiling point | 281.2±25.0 °C(Predicted) |
| Density | 1.4306 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.67±0.22(Predicted) |
| color | White to Light yellow |
| BRN | 1944995 |
| InChI | InChI=1S/C6H4FNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | ORPHLVJBJOCHBR-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1F |
| CAS DataBase Reference | 403-19-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Fluoro-4-nitrophenol (403-19-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |