2-Nitro-4-fluorophenol
- Product Name2-Nitro-4-fluorophenol
- CAS394-33-2
- MFC6H4FNO3
- MW157.1
- EINECS
- MOL File394-33-2.mol
Chemical Properties
| Melting point | 75-77 °C (lit.) |
| Boiling point | 234.1±20.0 °C(Predicted) |
| Density | 1.4306 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 6.76±0.14(Predicted) |
| color | Orange to Green to Amber |
| BRN | 1950412 |
| InChI | InChI=1S/C6H4FNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H |
| InChIKey | ZHRLVDHMIJDWSS-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 394-33-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-2-nitrophenol(394-33-2) |
| EPA Substance Registry System | 4-Fluoro-2-nitrophenol (394-33-2) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |