| Melting point |
>300 °C(lit.) |
| Density |
1.751 at 20℃ |
| vapor pressure |
15Pa at 20-50℃ |
| storage temp. |
-20°C |
| solubility |
H2O: 1 tablet/3 mL 25 mM, clear, light yellow |
| form |
tablets |
| color |
white to pale yellow |
| Water Solubility |
Miscible with water. Immiscible with ethanol and acetone. |
| BRN |
5324661 |
| Stability |
Stable, but may be light sensitive. Incompatible with strong acids, strong bases, strong oxidizing agents. |
| InChI |
1S/C6H6NO6P.2Na/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;;/h1-4H,(H2,10,11,12);;/q;2*+1/p-2 |
| InChIKey |
KAKKHKRHCKCAGH-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].[P](=O)([O-])([O-])Oc1ccc(cc1)[N+](=O)[O-] |
| LogP |
-2.16 at 22℃ and pH6.7 |
| Surface tension |
69.34mN/m at 1.051g/L and 20℃ |
| CAS DataBase Reference |
4264-83-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Phosphoric acid, mono(4-nitrophenyl) ester, disodium salt (4264-83-9) |
