Diphenylphosphoryl azide
- Product NameDiphenylphosphoryl azide
- CAS26386-88-9
- MFC12H10N3O3P
- MW275.2
- EINECS247-644-0
- MOL File26386-88-9.mol
Chemical Properties
| Boiling point | 157 °C/0.17 mmHg (lit.) |
| Density | 1.277 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Liquid |
| Specific Gravity | 1.277 |
| color | slightly yellow |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2058967 |
| Stability | Stable. Incompatible with acids, strong oxidizing agents. |
| InChI | 1S/C12H10N3O3P/c13-14-15-19(16,17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10H |
| InChIKey | SORGEQQSQGNZFI-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NP(=O)(Oc1ccccc1)Oc2ccccc2 |
| CAS DataBase Reference | 26386-88-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylphosphoryl azide(26386-88-9) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3278 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Toxic/Keep Cold |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29299000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

