Chemical Properties
| Melting point | 170-172℃ |
| Boiling point | 449.7±45.0 °C(Predicted) |
| Density | 1.358 |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO and methanol; |
| pka | 8.95±0.20(Predicted) |
| form | powder |
| color | White-yellowish |
| Water Solubility | slightly soluble in water |
| Major Application | food and beverages |
| InChI | 1S/C11H10O5/c1-14-8-5-7-6(3-4-9(12)16-7)11(15-2)10(8)13/h3-5,13H,1-2H3 |
| InChIKey | PBPNOAHYDPHKFH-UHFFFAOYSA-N |
| SMILES | [o]1c2c(c(c(c(c2)OC)O)OC)cc[c]1=O |
| CAS DataBase Reference | 486-28-2 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
