Melting point |
181-183 °C (lit.) |
Boiling point |
271.9±20.0 °C(Predicted) |
Density |
1.4016 (estimate) |
storage temp. |
Sealed in dry,Room Temperature |
solubility |
95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow |
form |
Powder or Flakes |
pka |
2.90±0.25(Predicted) |
color |
White |
BRN |
1946215 |
InChI |
InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
InChIKey |
GRPWQLDSGNZEQE-UHFFFAOYSA-N |
SMILES |
C(O)(=O)C1=CC=C(F)C=C1Cl |
CAS DataBase Reference |
2252-51-9(CAS DataBase Reference) |
NIST Chemistry Reference |
2-Chloro-4-fluorobenzoic acid(2252-51-9) |
EPA Substance Registry System |
Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |