2-Amino-4-fluorobenzoic acid
- Product Name2-Amino-4-fluorobenzoic acid
- CAS446-32-2
- MFC7H6FNO2
- MW155.13
- EINECS207-163-9
- MOL File446-32-2.mol
Chemical Properties
| Melting point | 192-196 °C (lit.) |
| Boiling point | 223.67°C (rough estimate) |
| Density | 1.3021 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.88±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 2803665 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) |
| InChIKey | LGPVTNAJFDUWLF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1N |
| CAS DataBase Reference | 446-32-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
