2-Chloro-4-fluorobenzoic acid
- Product Name2-Chloro-4-fluorobenzoic acid
- CAS2252-51-9
- CBNumberCB3413667
- MFC7H4ClFO2
- MW174.56
- EINECS218-845-0
- MDL NumberMFCD00010615
- MOL File2252-51-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 181-183 °C (lit.) |
| Boiling point | 271.9±20.0 °C(Predicted) |
| Density | 1.4016 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow |
| form | Powder or Flakes |
| pka | 2.90±0.25(Predicted) |
| color | White |
| BRN | 1946215 |
| InChI | InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2252-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorobenzoic acid(2252-51-9) |
| EPA Substance Registry System | Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-37/38-41-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-37/39-36 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

