2252-51-9
| Name | 2-Chloro-4-fluorobenzoic acid |
| CAS | 2252-51-9 |
| EINECS(EC#) | 218-845-0 |
| Molecular Formula | C7H4ClFO2 |
| MDL Number | MFCD00010615 |
| Molecular Weight | 174.56 |
| MOL File | 2252-51-9.mol |
Chemical Properties
| Appearance | white powder or flakes |
| Melting point | 181-183 °C (lit.) |
| Boiling point | 271.9±20.0 °C(Predicted) |
| density | 1.4016 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow |
| form | Powder or Flakes |
| pka | 2.90±0.25(Predicted) |
| color | White |
| BRN | 1946215 |
| InChI | InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2252-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorobenzoic acid(2252-51-9) |
| EPA Substance Registry System | Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |