60702-69-4
| Name | 2-Chloro-4-fluorobenzonitrile |
| CAS | 60702-69-4 |
| EINECS(EC#) | 262-384-8 |
| Molecular Formula | C7H3ClFN |
| MDL Number | MFCD00042523 |
| Molecular Weight | 155.56 |
| MOL File | 60702-69-4.mol |
Chemical Properties
| Appearance | semi-transparent crystalline chunks |
| Melting point | 64-66 °C(lit.) |
| Boiling point | 233.4±20.0 °C(Predicted) |
| density | 1.3760 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 6323034 |
| InChI | InChI=1S/C7H3ClFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H |
| InChIKey | PGKPNNMOFHNZJX-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 60702-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorobenzonitrile(60702-69-4) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |