
73231-34-2
| Name | 2,2-Dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| CAS | 73231-34-2 |
| EINECS(EC#) | 642-986-0 |
| Molecular Formula | C12H14Cl2FNO4S |
| MDL Number | MFCD00864834 |
| Molecular Weight | 358.21 |
| MOL File | 73231-34-2.mol |
Chemical Properties
| Appearance | White Crystalline Powder |
| Melting point | 153 °C |
| alpha | 26 +17.9° (DMF) |
| Boiling point | 618℃ |
| density | 1.451±0.06 g/cm3(Predicted) |
| RTECS | DB6034000 |
| Fp | >110°(230°F) |
| storage temp. | 0-6°C |
| solubility | Soluble in ethanol to 25mM and in DMSO to 100mM |
| form | solid |
| pka | 10.73±0.46(Predicted) |
| color | White to Off-White |
| Usage | Fluorinated derivative of thiamphenicol. Inhibits bacterial protein synthesis by binding to ribosome 50S and 70S subunits. An antibacterial |
| Merck | 14,4109 |
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1 |
| InChIKey | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| SMILES | C(N[C@H](CF)[C@H](O)C1=CC=C(S(C)(=O)=O)C=C1)(=O)C(Cl)Cl |
| CAS DataBase Reference | 73231-34-2(CAS DataBase Reference) |
| EPA Substance Registry System | Florfenicol (73231-34-2) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H410-H400-H361-H372 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P273-P391-P501-P273-P391-P501-P260-P264-P270-P314-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29419000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 1 |

