
625-98-9
| Name | 1-Chloro-3-fluorobenzene |
| CAS | 625-98-9 |
| EINECS(EC#) | 210-919-0 |
| Molecular Formula | C6H4ClF |
| MDL Number | MFCD00000569 |
| Molecular Weight | 130.55 |
| MOL File | 625-98-9.mol |
Chemical Properties
| Appearance | Clear colourless to light yellow liquid |
| Melting point | <-78 °C |
| Boiling point | 126-128 °C(lit.) |
| density | 1.219 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 68 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.219 |
| Water Solubility | Not miscible in water. |
| BRN | 2039303 |
| InChI | InChI=1S/C6H4ClF/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | VZHJIJZEOCBKRA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(F)=C1 |
| CAS DataBase Reference | 625-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-3-fluoro-(625-98-9) |
| EPA Substance Registry System | 625-98-9(EPA Substance) |
Safety Data
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |