
452-73-3
| Name | 2-Chloro-4-fluorotoluene |
| CAS | 452-73-3 |
| EINECS(EC#) | 207-209-8 |
| Molecular Formula | C7H6ClF |
| MDL Number | MFCD00000572 |
| Molecular Weight | 144.57 |
| MOL File | 452-73-3.mol |
Chemical Properties
| Appearance | colorless to light yellow liqui |
| Boiling point | 154-156 °C (lit.) |
| density | 1.197 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 122 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.197 |
| Detection Methods | GC |
| BRN | 1931690 |
| InChI | InChI=1S/C7H6ClF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | CSARJIQZOSVYHA-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 452-73-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorotoluene(452-73-3) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

