4-Benzylaniline
- Product Name4-Benzylaniline
- CAS1135-12-2
- MFC13H13N
- MW183.25
- EINECS672-757-0
- MOL File1135-12-2.mol
Chemical Properties
| Melting point | 38 °C |
| Boiling point | 142-144°C 1mm |
| Density | 1.0380 |
| refractive index | 1.6118 (estimate) |
| Flash point | 160 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 2.17(at 25℃) |
| form | powder to crystal |
| color | White to Gray to Brown |
| BRN | 2208463 |
| InChI | InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| InChIKey | WDTRNCFZFQIWLM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(CC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 1135-12-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2921420090 |
| Storage Class | 11 - Combustible Solids |
