4-Nitrobenzophenone
- Product Name4-Nitrobenzophenone
- CAS1144-74-7
- MFC13H9NO3
- MW227.22
- EINECS214-542-2
- MOL File1144-74-7.mol
Chemical Properties
| Melting point | 136-138 °C (lit.) |
| Boiling point | 368.92°C (rough estimate) |
| Density | 1.4060 |
| refractive index | 1.5880 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1912753 |
| InChI | InChI=1S/C13H9NO3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h1-9H |
| InChIKey | ZYMCBJWUWHHVRX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C([N+]([O-])=O)C=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 1144-74-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (4-nitrophenyl)phenyl-(1144-74-7) |
| EPA Substance Registry System | Methanone, (4-nitrophenyl)phenyl- (1144-74-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |