2,6-Diaminoanthraquinone
- Product Name2,6-Diaminoanthraquinone
- CAS131-14-6
- MFC14H10N2O2
- MW238.24
- EINECS205-013-7
- MOL File131-14-6.mol
Chemical Properties
| Melting point | >325 °C (lit.) |
| Boiling point | 380.84°C (rough estimate) |
| Density | 1.1907 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | insoluble in Chloroform |
| form | powder to crystal |
| pka | 1.32±0.20(Predicted) |
| color | Reddish-brown |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H10N2O2/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6H,15-16H2 |
| InChIKey | WQOWBWVMZPPPGX-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC(N)=C3)=CC=C1N |
| CAS DataBase Reference | 131-14-6(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 2,6-diamino- (131-14-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB6450000 |
| TSCA | TSCA listed |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | eye-rbt 500 mg/24H MLD 28ZPAK -,122,72 |