Desogestrel
- Product NameDesogestrel
- CAS54024-22-5
- MFC22H30O
- MW310.47
- EINECS258-929-4
- MOL File54024-22-5.mol
Chemical Properties
| Melting point | 109-110°C |
| alpha | D20 +55° (chloroform) |
| Boiling point | 390.62°C (rough estimate) |
| Density | 1.0169 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Practically insoluble in water, very soluble in methanol, freely soluble in anhydrous ethanol and in methylene chloride. |
| form | Solid |
| pka | 13.07±0.40(Predicted) |
| color | White to Almost white |
| Merck | 14,2926 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C22H30O/c1-4-21-14-15(3)20-17-9-7-6-8-16(17)10-11-18(20)19(21)12-13-22(21,23)5-2/h2,8,17-20,23H,3-4,6-7,9-14H2,1H3 |
| InChIKey | RPLCPCMSCLEKRS-UHFFFAOYSA-N |
| SMILES | C1C2C(CCC3C2C(=C)CC2(CC)C3CCC2(C#C)O)=CCC1 |
Safety Information
| Safety Statements | 24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | JF7975000 |
| HS Code | 29372390 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Hazardous Substances Data | 54024-22-5(Hazardous Substances Data) |
