1,4-Cyclohexanediol
- Product Name1,4-Cyclohexanediol
- CAS556-48-9
- MFC6H12O2
- MW116.16
- EINECS209-126-2
- MOL File556-48-9.mol
Chemical Properties
| Melting point | 98-100 °C (lit.) |
| Boiling point | 150 °C/20 mmHg (lit.) |
| Density | 0.9958 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| Flash point | 150 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.75±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | It is highly soluble in water. |
| BRN | 2036658 |
| InChI | InChI=1S/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2 |
| InChIKey | VKONPUDBRVKQLM-UHFFFAOYSA-N |
| SMILES | C1(O)CCC(O)CC1 |
| CAS DataBase Reference | 556-48-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Cyclohexanediol(556-48-9) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38 |
| Safety Statements | 24/25-36-26 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29061900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |
