2-Amino-6-methoxybenzothiazole
- Product Name2-Amino-6-methoxybenzothiazole
- CAS1747-60-0
- MFC8H8N2OS
- MW180.23
- EINECS217-130-0
- MOL File1747-60-0.mol
Chemical Properties
| Melting point | 165-167 °C (lit.) |
| Boiling point | 240°C |
| Density | 1.2425 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very slightly in Methanol |
| form | Crystalline Powder |
| pka | pK1: 4.50(+1) (25°C) |
| color | White to beige |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Stability | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H8N2OS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3,(H2,9,10) |
| InChIKey | KZHGPDSVHSDCMX-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OC)=CC=C2N=C1N |
| CAS DataBase Reference | 1747-60-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Amino-6-methoxybenzothiazole (1747-60-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DL2100000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29342080 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,intravenous,140mg/kg (140mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 105, Pg. 486, 1952. |