2,2'-Dithiobis(benzothiazole)
- Product Name2,2'-Dithiobis(benzothiazole)
- CAS120-78-5
- MFC14H8N2S4
- MW332.49
- EINECS204-424-9
- MOL File120-78-5.mol
Chemical Properties
| Melting point | 177-180 °C (lit.) |
| Boiling point | 532.5±33.0 °C(Predicted) |
| Density | 1.5 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5700 (estimate) |
| Flash point | 271°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 0.01g/l |
| pka | -0.58±0.10(Predicted) |
| form | powder to crystal |
| color | Cream to pale-yellow powder |
| Odor | gray-wh. to cream powd. or pellets, sl. odor |
| Water Solubility | <0.01 g/100 mL at 21 ºC |
| Merck | 14,3370 |
| Henry's Law Constant | 4.2×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C14H8N2S4/c1-3-7-11-9(5-1)15-13(17-11)19-20-14-16-10-6-2-4-8-12(10)18-14/h1-8H |
| InChIKey | AFZSMODLJJCVPP-UHFFFAOYSA-N |
| SMILES | S(Sc1nc2ccccc2s1)c3nc4ccccc4s3 |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 31-43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DL4550000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29342020 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 120-78-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 12gm/kg |
