Buspirone Hcl
- Product NameBuspirone Hcl
- CAS33386-08-2
- CBNumberCB00131102
- MFC21H32ClN5O2
- MW421.96
- EINECS251-489-4
- MDL NumberMFCD00078569
- MOL File33386-08-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 201.5-202.50C |
| Flash point | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in methanol, practically insoluble in acetone. |
| form | Solid |
| color | White to off-white |
| Water Solubility | Soluble in methanol (50 mg/ml), water (partly), DMSO (100 mM). |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C21H31N5O2.ClH/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20;/h5,8-9H,1-4,6-7,10-17H2;1H |
| InChIKey | RICLFGYGYQXUFH-UHFFFAOYSA-N |
| SMILES | C12(CCCC1)CC(N(CCCCN1CCN(C3=NC=CC=N3)CC1)C(=O)C2)=O.Cl |
| CAS DataBase Reference | 33386-08-2(CAS DataBase Reference) |
| FDA UNII | 207LT9J9OC |
| NCI Drug Dictionary | buspirone hydrochloride |
| Comptox DTXSID | DTXSID1037193 |
| UNSPSC Code | 41116107 |
| NACRES | NA.77 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P264-P270-P301+P310-P405-P501 | |||||||||
| Hazard Codes | T,Xn,F | |||||||||
| Risk Statements | 25-36/37/38-20/21/22-39/23/24/25-23/24/25-11 | |||||||||
| Safety Statements | 45-36-26-36/37-16 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | CL9915000 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29335995 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| Toxicity | LD50 i.p. in rats: 136 mg/kg (Allen) | |||||||||
| NFPA 704: |
|
