Buspirone Hcl
- Product NameBuspirone Hcl
- CAS33386-08-2
- MFC21H32ClN5O2
- MW421.96
- EINECS251-489-4
- MOL File33386-08-2.mol
Chemical Properties
| Melting point | 201.5-202.50C |
| Flash point | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in methanol, practically insoluble in acetone. |
| form | Solid |
| color | White to off-white |
| Water Solubility | Soluble in methanol (50 mg/ml), water (partly), DMSO (100 mM). |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C21H31N5O2.ClH/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20;/h5,8-9H,1-4,6-7,10-17H2;1H |
| InChIKey | RICLFGYGYQXUFH-UHFFFAOYSA-N |
| SMILES | C12(CCCC1)CC(N(CCCCN1CCN(C3=NC=CC=N3)CC1)C(=O)C2)=O.Cl |
| CAS DataBase Reference | 33386-08-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xn,F |
| Risk Statements | 25-36/37/38-20/21/22-39/23/24/25-23/24/25-11 |
| Safety Statements | 45-36-26-36/37-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CL9915000 |
| HazardClass | 6.1 |
| HS Code | 29335995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 i.p. in rats: 136 mg/kg (Allen) |
