3,3-Tetramethyleneglutarimide
- Product Name3,3-Tetramethyleneglutarimide
- CAS1075-89-4
- MFC9H13NO2
- MW167.21
- EINECS427-770-4
- MOL File1075-89-4.mol
Chemical Properties
| Melting point | 153-155 °C |
| Boiling point | 295.79°C (rough estimate) |
| Density | 1.1222 (rough estimate) |
| refractive index | 1.4760 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 11.71±0.20(Predicted) |
| color | White to Almost white |
| BRN | 383702 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H13NO2/c11-7-5-9(3-1-2-4-9)6-8(12)10-7/h1-6H2,(H,10,11,12) |
| InChIKey | YRTHJMQKDCXPAY-UHFFFAOYSA-N |
| SMILES | C1C2(CC(=O)NC(=O)C2)CCC1 |
| CAS DataBase Reference | 1075-89-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1-Cyclopentanediacetimide(1075-89-4) |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 45-36/37/39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29251995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 |
