
775-15-5
| Name | N-Benzyl-3-pyrrolidinol |
| CAS | 775-15-5 |
| EINECS(EC#) | 212-273-5 |
| Molecular Formula | C11H15NO |
| MDL Number | MFCD00012132 |
| Molecular Weight | 177.24 |
| MOL File | 775-15-5.mol |
Chemical Properties
| Boiling point | 113-115 °C2 mm Hg(lit.) |
| density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 14.82±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| BRN | 6039 |
| InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2 |
| InChIKey | YQMXOIAIYXXXEE-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(O)C1 |
| CAS DataBase Reference | 775-15-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 1 |
| F | 10-34 |
| HazardClass | 6.1 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |