76855-69-1
| Name | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one |
| CAS | 76855-69-1 |
| EINECS(EC#) | 408-050-9 |
| Molecular Formula | C13H25NO4Si |
| MDL Number | MFCD00077636 |
| Molecular Weight | 287.43 |
| MOL File | 76855-69-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 107-109 °C(lit.) |
| alpha | 51 º (c=1, chloroform) |
| Boiling point | 358.3±27.0 °C(Predicted) |
| density | 1.03±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 12.86±0.60(Predicted) |
| color | White to Almost white |
| Optical Rotation | [α]20/D +51°, c = 1 in chloroform |
| Detection Methods | HPLC |
| InChI | InChI=1S/C13H25NO4Si/c1-8(18-19(6,7)13(3,4)5)10-11(16)14-12(10)17-9(2)15/h8,10,12H,1-7H3,(H,14,16)/t8-,10+,12-/m1/s1 |
| InChIKey | GWHDKFODLYVMQG-UBHAPETDSA-N |
| SMILES | N1[C@H](OC(C)=O)[C@@H]([C@H](O[Si](C(C)(C)C)(C)C)C)C1=O |
| CAS DataBase Reference | 76855-69-1(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen;Moisture sensitive |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H319-H411 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Sens. 1 |