
56553-60-7
| Name | Sodium triacetoxyborohydride |
| CAS | 56553-60-7 |
| EINECS(EC#) | 411-950-4 |
| Molecular Formula | C6H10BNaO6 |
| MDL Number | MFCD00012211 |
| Molecular Weight | 211.94 |
| MOL File | 56553-60-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 116-120 °C (dec.) (lit.) |
| Boiling point | 111.1℃[at 101 325 Pa] |
| density | 1.36[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Flammables + water-Freezer (-20°C)e area |
| solubility | Soluble in dimethyl sulfoxide, methanol, benzene, toluene, terahydrofuran, dioxane and methylene chloride. |
| form | Powder |
| color | White |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Detection Methods | T,NMR,MS |
| Merck | 8695 |
| BRN | 4047608 |
| InChI | 1S/C6H10BO6.Na/c1-4(8)11-7(12-5(2)9)13-6(3)10;/h7H,1-3H3;/q-1;+1 |
| InChIKey | HHYFEYBWNZJVFQ-UHFFFAOYSA-N |
| SMILES | [Na+].CC(=O)O[BH-](OC(C)=O)OC(C)=O |
| LogP | -2.88--1.09 at 20℃ |
| CAS DataBase Reference | 56553-60-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H228-H260-H302-H318-H360FD |
| Precautionary statements | P210-P231+P232-P280-P301+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | F,Xi,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1409 4.3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant/Flammable |
| TSCA | Yes |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Sol. 1 Repr. 1B Water-react 1 |




