64485-82-1
| Name | Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate |
| CAS | 64485-82-1 |
| EINECS(EC#) | 264-910-1 |
| Molecular Formula | C7H9N3O3S |
| MDL Number | MFCD00010415 |
| Molecular Weight | 215.23 |
| MOL File | 64485-82-1.mol |
Chemical Properties
| Appearance | light yellow to beige fine powder |
| Melting point | 195-197 °C(lit.) |
| Boiling point | 426.8±37.0 °C(Predicted) |
| density | 1.4565 (rough estimate) |
| refractive index | 1.6630 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.53±0.70(Predicted) |
| color | Off-White to Light Tan |
| Detection Methods | T,NMR |
| InChI | InChI=1S/C7H9N3O3S/c1-2-13-6(11)5(10-12)4-3-14-7(8)9-4/h3,12H,2H2,1H3,(H2,8,9)/b10-5- |
| InChIKey | BTEPYCPXBCCSDL-YHYXMXQVSA-N |
| SMILES | C(=N/O)(/C(=O)OCC)\C1=CSC(N)=N1 |
| CAS DataBase Reference | 64485-82-1(CAS DataBase Reference) |
| Storage Precautions | Moisture sensitive |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |