619-21-6
| Name | 3-Carboxybenzaldehyde |
| CAS | 619-21-6 |
| EINECS(EC#) | 210-585-6 |
| Molecular Formula | C8H6O3 |
| MDL Number | MFCD00039575 |
| Molecular Weight | 150.13 |
| MOL File | 619-21-6.mol |
Chemical Properties
| Appearance | white to light yellow powder |
| Melting point | 173-175 °C(lit.) |
| Boiling point | 231.65°C (rough estimate) |
| density | 1.2645 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol (100 mg/mL) gives a clear to slightly hazy, colorless to very faintly brown. |
| form | Powder |
| pka | 3.84(at 25℃) |
| color | White to light yellow |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC,NMR,MS |
| BRN | 2206413 |
| InChI | InChI=1S/C8H6O3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5H,(H,10,11) |
| InChIKey | UHDNUPHSDMOGCR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C=O)=C1 |
| CAS DataBase Reference | 619-21-6(CAS DataBase Reference) |
| EPA Substance Registry System | 619-21-6(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
