25462-85-5
| Name | 2-Chloro-6-methylpyridine-4-carboxylic acid |
| CAS | 25462-85-5 |
| EINECS(EC#) | 626-878-0 |
| Molecular Formula | C7H6ClNO2 |
| MDL Number | MFCD00052830 |
| Molecular Weight | 171.58 |
| MOL File | 25462-85-5.mol |
Chemical Properties
| Melting point | 208-212 °C (dec.) (lit.) |
| Boiling point | 399.0±37.0 °C(Predicted) |
| density | 1.390±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.07±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 122809 |
| InChI | InChI=1S/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11) |
| InChIKey | ZGZMEKHQIZSZOH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 25462-85-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |