
30529-70-5
| Name | 2-Chloro-6-methylnicotinic acid |
| CAS | 30529-70-5 |
| EINECS(EC#) | 250-229-7 |
| Molecular Formula | C7H6ClNO2 |
| MDL Number | MFCD00134165 |
| Molecular Weight | 171.58 |
| MOL File | 30529-70-5.mol |
Chemical Properties
| Appearance | white to yellow crystalline powder |
| Melting point | 162-164 °C (lit.) |
| Boiling point | 163 °C / 22mmHg |
| density | 1.3246 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 2.28±0.28(Predicted) |
| color | White to yellow to beige |
| BRN | 473070 |
| InChI | InChI=1S/C7H6ClNO2/c1-4-2-3-5(7(10)11)6(8)9-4/h2-3H,1H3,(H,10,11) |
| InChIKey | ACQXHCHKMFYDPM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC=C1C(O)=O |
| CAS DataBase Reference | 30529-70-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
