
3998-90-1
| Name | Methyl 2-chloro-6-methylpyridine-4-carboxylate |
| CAS | 3998-90-1 |
| EINECS(EC#) | 627-727-1 |
| Molecular Formula | C8H8ClNO2 |
| MDL Number | MFCD04038391 |
| Molecular Weight | 185.61 |
| MOL File | 3998-90-1.mol |
Chemical Properties
| Melting point | 58-62 °C(lit.) |
| Boiling point | 124-125 °C7 mm Hg(lit.) |
| density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.19±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H8ClNO2/c1-5-3-6(8(11)12-2)4-7(9)10-5/h3-4H,1-2H3 |
| InChIKey | BDWMGYZSQKGUFA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 3998-90-1(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |