
35575-96-3
| Name | Azamethiphos |
| CAS | 35575-96-3 |
| EINECS(EC#) | 252-626-0 |
| Molecular Formula | C9H10ClN2O5PS |
| MDL Number | MFCD00867611 |
| Molecular Weight | 324.68 |
| MOL File | 35575-96-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 88-93°C |
| Boiling point | 428.8±55.0 °C(Predicted) |
| density | 1.566±0.06 g/cm3(Predicted) |
| vapor pressure | 4.9 x 10-6 Pa (20 °C) |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 0.94±0.20(Predicted) |
| Water Solubility | 1100 mg l-1 (20 °C) |
| color | White to off-white |
| Usage | Synergistic insecticidal and acaricidal organophosphorus compound |
| Henry's Law Constant | 3.0×105 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C9H10ClN2O5PS/c1-15-18(14,16-2)19-5-12-8-7(17-9(12)13)3-6(10)4-11-8/h3-4H,5H2,1-2H3 |
| InChIKey | VNKBTWQZTQIWDV-UHFFFAOYSA-N |
| SMILES | P(SCN1C2=NC=C(Cl)C=C2OC1=O)(OC)(OC)=O |
| CAS DataBase Reference | 35575-96-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphorothioic acid, s-[(6-chloro-2-oxooxazolo[4,5-b]pyridin-3(2h)-yl)methyl] o,o-dimethyl ester(35575-96-3) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TE8070000 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1 STOT SE 1 |
| Toxicity |