
23056-33-9
| Name | 2-Chloro-4-methyl-5-nitropyridine |
| CAS | 23056-33-9 |
| Molecular Formula | C6H5ClN2O2 |
| MDL Number | MFCD00010688 |
| Molecular Weight | 172.57 |
| MOL File | 23056-33-9.mol |
Chemical Properties
| Appearance | light cream to light brown crystalline powder |
| Melting point | 37-39 °C (lit.) |
| Boiling point | 91 °C/5 mmHg (lit.) |
| density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder or Chunks |
| pka | -3.42±0.10(Predicted) |
| color | Light cream to light brown |
| Detection Methods | HPLC |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-6(7)8-3-5(4)9(10)11/h2-3H,1H3 |
| InChIKey | HWZUMEVIIGNXGM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C(C)=C1 |
| CAS DataBase Reference | 23056-33-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
